C11H18N4S — CID 106476577
5,6-dimethyl-2-(4-methylpiperazin-1-yl)-1H-pyrimidine-4-thione (PubChem CID 106476577) has the molecular formula C11H18N4S and a molecular weight of 238.36 g/mol. Its IUPAC name is 5,6-dimethyl-2-(4-methylpiperazin-1-yl)-1H-pyrimidine-4-thione.
| Compound Name | 5,6-dimethyl-2-(4-methylpiperazin-1-yl)-1H-pyrimidine-4-thione |
|---|---|
| PubChem CID | 106476577 |
| Molecular Formula | C11H18N4S |
| Molecular Weight | 238.36 g/mol |
| Exact Mass | 238.13 |
| IUPAC Name | 5,6-dimethyl-2-(4-methylpiperazin-1-yl)-1H-pyrimidine-4-thione |
| SMILES | Cc1[nH]c(N2CCN(C)CC2)nc(=S)c1C |
| InChI | InChI=1S/C11H18N4S/c1-8-9(2)12-11(13-10(8)16)15-6-4-14(3)5-7-15/h4-7H2,1-3H3,(H,12,13,16) |
| InChIKey | QTFFLMIEHSWVIS-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 35.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.36 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|