C11H18N2S — CID 106476607
5,6-dimethyl-2-(3-methylbutyl)-1H-pyrimidine-4-thione (PubChem CID 106476607) has the molecular formula C11H18N2S and a molecular weight of 210.35 g/mol. Its IUPAC name is 5,6-dimethyl-2-(3-methylbutyl)-1H-pyrimidine-4-thione.
| Compound Name | 5,6-dimethyl-2-(3-methylbutyl)-1H-pyrimidine-4-thione |
|---|---|
| PubChem CID | 106476607 |
| Molecular Formula | C11H18N2S |
| Molecular Weight | 210.35 g/mol |
| Exact Mass | 210.12 |
| IUPAC Name | 5,6-dimethyl-2-(3-methylbutyl)-1H-pyrimidine-4-thione |
| SMILES | Cc1[nH]c(CCC(C)C)nc(=S)c1C |
| InChI | InChI=1S/C11H18N2S/c1-7(2)5-6-10-12-9(4)8(3)11(14)13-10/h7H,5-6H2,1-4H3,(H,12,13,14) |
| InChIKey | PCDBTZIRBSTWHR-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.35 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|