C12H21N3S — CID 106476684
2-[2-(diethylamino)ethyl]-5,6-dimethyl-1H-pyrimidine-4-thione (PubChem CID 106476684) has the molecular formula C12H21N3S and a molecular weight of 239.39 g/mol. Its IUPAC name is 2-[2-(diethylamino)ethyl]-5,6-dimethyl-1H-pyrimidine-4-thione.
| Compound Name | 2-[2-(diethylamino)ethyl]-5,6-dimethyl-1H-pyrimidine-4-thione |
|---|---|
| PubChem CID | 106476684 |
| Molecular Formula | C12H21N3S |
| Molecular Weight | 239.39 g/mol |
| Exact Mass | 239.15 |
| IUPAC Name | 2-[2-(diethylamino)ethyl]-5,6-dimethyl-1H-pyrimidine-4-thione |
| SMILES | CCN(CC)CCc1nc(=S)c(C)c(C)[nH]1 |
| InChI | InChI=1S/C12H21N3S/c1-5-15(6-2)8-7-11-13-10(4)9(3)12(16)14-11/h5-8H2,1-4H3,(H,13,14,16) |
| InChIKey | BVIVCSAJTLVWMK-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 31.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.39 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|