C8H9N5S — CID 106476719
5,6-dimethyl-2-(1H-1,2,4-triazol-5-yl)-1H-pyrimidine-4-thione (PubChem CID 106476719) has the molecular formula C8H9N5S and a molecular weight of 207.26 g/mol. Its IUPAC name is 5,6-dimethyl-2-(1H-1,2,4-triazol-5-yl)-1H-pyrimidine-4-thione.
| Compound Name | 5,6-dimethyl-2-(1H-1,2,4-triazol-5-yl)-1H-pyrimidine-4-thione |
|---|---|
| PubChem CID | 106476719 |
| Molecular Formula | C8H9N5S |
| Molecular Weight | 207.26 g/mol |
| Exact Mass | 207.06 |
| IUPAC Name | 5,6-dimethyl-2-(1H-1,2,4-triazol-5-yl)-1H-pyrimidine-4-thione |
| SMILES | Cc1[nH]c(-c2ncn[nH]2)nc(=S)c1C |
| InChI | InChI=1S/C8H9N5S/c1-4-5(2)11-7(12-8(4)14)6-9-3-10-13-6/h3H,1-2H3,(H,9,10,13)(H,11,12,14) |
| InChIKey | LSFPZQYBEDEFFK-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 70.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.26 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|