About 2-(1-methoxypropyl)-5,6-dimethyl-1H-pyrimidine-4-thione
2-(1-methoxypropyl)-5,6-dimethyl-1H-pyrimidine-4-thione (PubChem CID 106476744) has the molecular formula C10H16N2OS
and a molecular weight of 212.32 g/mol. Its IUPAC name is 2-(1-methoxypropyl)-5,6-dimethyl-1H-pyrimidine-4-thione.
Molecular Properties
| Compound Name | 2-(1-methoxypropyl)-5,6-dimethyl-1H-pyrimidine-4-thione |
| PubChem CID | 106476744 |
| Molecular Formula | C10H16N2OS |
| Molecular Weight | 212.32 g/mol |
| Exact Mass | 212.10 |
| IUPAC Name | 2-(1-methoxypropyl)-5,6-dimethyl-1H-pyrimidine-4-thione |
| SMILES | CCC(OC)c1nc(=S)c(C)c(C)[nH]1 |
| InChI | InChI=1S/C10H16N2OS/c1-5-8(13-4)9-11-7(3)6(2)10(14)12-9/h8H,5H2,1-4H3,(H,11,12,14) |
| InChIKey | LOAGVTMAUGAQJC-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 37.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.32 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 2-(1-methoxypropyl)-5,6-dimethyl-1H-pyrimidine-4-thione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1-methoxypropyl)-5,6-dimethyl-1H-pyrimidine-4-thione?
The IUPAC name of 2-(1-methoxypropyl)-5,6-dimethyl-1H-pyrimidine-4-thione (CID 106476744) is 2-(1-methoxypropyl)-5,6-dimethyl-1H-pyrimidine-4-thione.
What is the SMILES notation for 2-(1-methoxypropyl)-5,6-dimethyl-1H-pyrimidine-4-thione?
The canonical SMILES for 2-(1-methoxypropyl)-5,6-dimethyl-1H-pyrimidine-4-thione is CCC(OC)c1nc(=S)c(C)c(C)[nH]1.
What is the InChIKey of 2-(1-methoxypropyl)-5,6-dimethyl-1H-pyrimidine-4-thione?
The InChIKey is LOAGVTMAUGAQJC-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16N2OS/c1-5-8(13-4)9-11-7(3)6(2)10(14)12-9/h8H,5H2,1-4H3,(H,11,12,14).
What are the key properties of 2-(1-methoxypropyl)-5,6-dimethyl-1H-pyrimidine-4-thione?
2-(1-methoxypropyl)-5,6-dimethyl-1H-pyrimidine-4-thione has a molecular weight of 212.32 g/mol, XLogP of 2.85, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1-methoxypropyl)-5,6-dimethyl-1H-pyrimidine-4-thione is sourced from PubChem (CID 106476744), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).