C8H12N2S2 — CID 106476797
5,6-dimethyl-2-(methylsulfanylmethyl)-1H-pyrimidine-4-thione (PubChem CID 106476797) has the molecular formula C8H12N2S2 and a molecular weight of 200.33 g/mol. Its IUPAC name is 5,6-dimethyl-2-(methylsulfanylmethyl)-1H-pyrimidine-4-thione.
| Compound Name | 5,6-dimethyl-2-(methylsulfanylmethyl)-1H-pyrimidine-4-thione |
|---|---|
| PubChem CID | 106476797 |
| Molecular Formula | C8H12N2S2 |
| Molecular Weight | 200.33 g/mol |
| Exact Mass | 200.04 |
| IUPAC Name | 5,6-dimethyl-2-(methylsulfanylmethyl)-1H-pyrimidine-4-thione |
| SMILES | CSCc1nc(=S)c(C)c(C)[nH]1 |
| InChI | InChI=1S/C8H12N2S2/c1-5-6(2)9-7(4-12-3)10-8(5)11/h4H2,1-3H3,(H,9,10,11) |
| InChIKey | RUZALAICHNDVRB-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.33 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|