C9H14N2S2 — CID 106476809
2-(ethylsulfanylmethyl)-5,6-dimethyl-1H-pyrimidine-4-thione (PubChem CID 106476809) has the molecular formula C9H14N2S2 and a molecular weight of 214.36 g/mol. Its IUPAC name is 2-(ethylsulfanylmethyl)-5,6-dimethyl-1H-pyrimidine-4-thione.
| Compound Name | 2-(ethylsulfanylmethyl)-5,6-dimethyl-1H-pyrimidine-4-thione |
|---|---|
| PubChem CID | 106476809 |
| Molecular Formula | C9H14N2S2 |
| Molecular Weight | 214.36 g/mol |
| Exact Mass | 214.06 |
| IUPAC Name | 2-(ethylsulfanylmethyl)-5,6-dimethyl-1H-pyrimidine-4-thione |
| SMILES | CCSCc1nc(=S)c(C)c(C)[nH]1 |
| InChI | InChI=1S/C9H14N2S2/c1-4-13-5-8-10-7(3)6(2)9(12)11-8/h4-5H2,1-3H3,(H,10,11,12) |
| InChIKey | JQNUAMCCMAGUMG-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.36 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|