C9H11F3N2S — CID 106476847
5-ethyl-6-methyl-2-(2,2,2-trifluoroethyl)-1H-pyrimidine-4-thione (PubChem CID 106476847) has the molecular formula C9H11F3N2S and a molecular weight of 236.26 g/mol. Its IUPAC name is 5-ethyl-6-methyl-2-(2,2,2-trifluoroethyl)-1H-pyrimidine-4-thione.
| Compound Name | 5-ethyl-6-methyl-2-(2,2,2-trifluoroethyl)-1H-pyrimidine-4-thione |
|---|---|
| PubChem CID | 106476847 |
| Molecular Formula | C9H11F3N2S |
| Molecular Weight | 236.26 g/mol |
| Exact Mass | 236.06 |
| IUPAC Name | 5-ethyl-6-methyl-2-(2,2,2-trifluoroethyl)-1H-pyrimidine-4-thione |
| SMILES | CCc1c(C)[nH]c(CC(F)(F)F)nc1=S |
| InChI | InChI=1S/C9H11F3N2S/c1-3-6-5(2)13-7(14-8(6)15)4-9(10,11)12/h3-4H2,1-2H3,(H,13,14,15) |
| InChIKey | GBJKILNEUZKPGB-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.26 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|