C11H12N2OS — CID 106476851
5-ethyl-2-(furan-3-yl)-6-methyl-1H-pyrimidine-4-thione (PubChem CID 106476851) has the molecular formula C11H12N2OS and a molecular weight of 220.30 g/mol. Its IUPAC name is 5-ethyl-2-(furan-3-yl)-6-methyl-1H-pyrimidine-4-thione.
| Compound Name | 5-ethyl-2-(furan-3-yl)-6-methyl-1H-pyrimidine-4-thione |
|---|---|
| PubChem CID | 106476851 |
| Molecular Formula | C11H12N2OS |
| Molecular Weight | 220.30 g/mol |
| Exact Mass | 220.07 |
| IUPAC Name | 5-ethyl-2-(furan-3-yl)-6-methyl-1H-pyrimidine-4-thione |
| SMILES | CCc1c(C)[nH]c(-c2ccoc2)nc1=S |
| InChI | InChI=1S/C11H12N2OS/c1-3-9-7(2)12-10(13-11(9)15)8-4-5-14-6-8/h4-6H,3H2,1-2H3,(H,12,13,15) |
| InChIKey | ZIAHWDZHLDJDOO-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 41.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.30 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|