C14H17N3OS — CID 106476916
5-ethyl-2-[(6-methoxy-3-pyridinyl)methyl]-6-methyl-1H-pyrimidine-4-thione (PubChem CID 106476916) has the molecular formula C14H17N3OS and a molecular weight of 275.38 g/mol. Its IUPAC name is 5-ethyl-2-[(6-methoxy-3-pyridinyl)methyl]-6-methyl-1H-pyrimidine-4-thione.
| Compound Name | 5-ethyl-2-[(6-methoxy-3-pyridinyl)methyl]-6-methyl-1H-pyrimidine-4-thione |
|---|---|
| PubChem CID | 106476916 |
| Molecular Formula | C14H17N3OS |
| Molecular Weight | 275.38 g/mol |
| Exact Mass | 275.11 |
| IUPAC Name | 5-ethyl-2-[(6-methoxy-3-pyridinyl)methyl]-6-methyl-1H-pyrimidine-4-thione |
| SMILES | CCc1c(C)[nH]c(Cc2ccc(OC)nc2)nc1=S |
| InChI | InChI=1S/C14H17N3OS/c1-4-11-9(2)16-12(17-14(11)19)7-10-5-6-13(18-3)15-8-10/h5-6,8H,4,7H2,1-3H3,(H,16,17,19) |
| InChIKey | LRQFWCVHGAAOQQ-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.38 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|