C15H20N2S — CID 106477096
2-(2-bicyclo[2.2.1]heptanyl)-5,6,7,8-tetrahydro-1H-quinazoline-4-thione (PubChem CID 106477096) has the molecular formula C15H20N2S and a molecular weight of 260.41 g/mol. Its IUPAC name is 2-(2-bicyclo[2.2.1]heptanyl)-5,6,7,8-tetrahydro-1H-quinazoline-4-thione.
| Compound Name | 2-(2-bicyclo[2.2.1]heptanyl)-5,6,7,8-tetrahydro-1H-quinazoline-4-thione |
|---|---|
| PubChem CID | 106477096 |
| Molecular Formula | C15H20N2S |
| Molecular Weight | 260.41 g/mol |
| Exact Mass | 260.13 |
| IUPAC Name | 2-(2-bicyclo[2.2.1]heptanyl)-5,6,7,8-tetrahydro-1H-quinazoline-4-thione |
| SMILES | S=c1nc(C2CC3CCC2C3)[nH]c2c1CCCC2 |
| InChI | InChI=1S/C15H20N2S/c18-15-11-3-1-2-4-13(11)16-14(17-15)12-8-9-5-6-10(12)7-9/h9-10,12H,1-8H2,(H,16,17,18) |
| InChIKey | ODQWKOJNSKVTFV-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.41 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|