C12H12N2S2 — CID 106477146
2-thiophen-2-yl-5,6,7,8-tetrahydro-1H-quinazoline-4-thione (PubChem CID 106477146) has the molecular formula C12H12N2S2 and a molecular weight of 248.38 g/mol. Its IUPAC name is 2-thiophen-2-yl-5,6,7,8-tetrahydro-1H-quinazoline-4-thione.
| Compound Name | 2-thiophen-2-yl-5,6,7,8-tetrahydro-1H-quinazoline-4-thione |
|---|---|
| PubChem CID | 106477146 |
| Molecular Formula | C12H12N2S2 |
| Molecular Weight | 248.38 g/mol |
| Exact Mass | 248.04 |
| IUPAC Name | 2-thiophen-2-yl-5,6,7,8-tetrahydro-1H-quinazoline-4-thione |
| SMILES | S=c1nc(-c2cccs2)[nH]c2c1CCCC2 |
| InChI | InChI=1S/C12H12N2S2/c15-12-8-4-1-2-5-9(8)13-11(14-12)10-6-3-7-16-10/h3,6-7H,1-2,4-5H2,(H,13,14,15) |
| InChIKey | RTKPBYIXTWGFFC-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.38 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|