C16H24N2OS — CID 106477288
2-[cyclohexyl(methoxy)methyl]-5,6,7,8-tetrahydro-1H-quinazoline-4-thione (PubChem CID 106477288) has the molecular formula C16H24N2OS and a molecular weight of 292.45 g/mol. Its IUPAC name is 2-[cyclohexyl(methoxy)methyl]-5,6,7,8-tetrahydro-1H-quinazoline-4-thione.
| Compound Name | 2-[cyclohexyl(methoxy)methyl]-5,6,7,8-tetrahydro-1H-quinazoline-4-thione |
|---|---|
| PubChem CID | 106477288 |
| Molecular Formula | C16H24N2OS |
| Molecular Weight | 292.45 g/mol |
| Exact Mass | 292.16 |
| IUPAC Name | 2-[cyclohexyl(methoxy)methyl]-5,6,7,8-tetrahydro-1H-quinazoline-4-thione |
| SMILES | COC(c1nc(=S)c2c([nH]1)CCCC2)C1CCCCC1 |
| InChI | InChI=1S/C16H24N2OS/c1-19-14(11-7-3-2-4-8-11)15-17-13-10-6-5-9-12(13)16(20)18-15/h11,14H,2-10H2,1H3,(H,17,18,20) |
| InChIKey | XCJIRQIBTABJDM-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 37.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.45 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|