C14H18N2S — CID 106477342
2-(2-bicyclo[2.2.1]heptanyl)-1,5,6,7-tetrahydrocyclopenta[d]pyrimidine-4-thione (PubChem CID 106477342) has the molecular formula C14H18N2S and a molecular weight of 246.38 g/mol. Its IUPAC name is 2-(2-bicyclo[2.2.1]heptanyl)-1,5,6,7-tetrahydrocyclopenta[d]pyrimidine-4-thione.
| Compound Name | 2-(2-bicyclo[2.2.1]heptanyl)-1,5,6,7-tetrahydrocyclopenta[d]pyrimidine-4-thione |
|---|---|
| PubChem CID | 106477342 |
| Molecular Formula | C14H18N2S |
| Molecular Weight | 246.38 g/mol |
| Exact Mass | 246.12 |
| IUPAC Name | 2-(2-bicyclo[2.2.1]heptanyl)-1,5,6,7-tetrahydrocyclopenta[d]pyrimidine-4-thione |
| SMILES | S=c1nc(C2CC3CCC2C3)[nH]c2c1CCC2 |
| InChI | InChI=1S/C14H18N2S/c17-14-10-2-1-3-12(10)15-13(16-14)11-7-8-4-5-9(11)6-8/h8-9,11H,1-7H2,(H,15,16,17) |
| InChIKey | DTFQCVXLCVGLSO-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.38 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|