C12H17N3S — CID 106477353
2-piperidin-1-yl-1,5,6,7-tetrahydrocyclopenta[d]pyrimidine-4-thione (PubChem CID 106477353) has the molecular formula C12H17N3S and a molecular weight of 235.36 g/mol. Its IUPAC name is 2-piperidin-1-yl-1,5,6,7-tetrahydrocyclopenta[d]pyrimidine-4-thione.
| Compound Name | 2-piperidin-1-yl-1,5,6,7-tetrahydrocyclopenta[d]pyrimidine-4-thione |
|---|---|
| PubChem CID | 106477353 |
| Molecular Formula | C12H17N3S |
| Molecular Weight | 235.36 g/mol |
| Exact Mass | 235.11 |
| IUPAC Name | 2-piperidin-1-yl-1,5,6,7-tetrahydrocyclopenta[d]pyrimidine-4-thione |
| SMILES | S=c1nc(N2CCCCC2)[nH]c2c1CCC2 |
| InChI | InChI=1S/C12H17N3S/c16-11-9-5-4-6-10(9)13-12(14-11)15-7-2-1-3-8-15/h1-8H2,(H,13,14,16) |
| InChIKey | OGKMWCVHPXGJAX-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 31.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.36 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|