C13H18N2S3 — CID 106477468
2-(5,6-dimethyl-1,4-dithian-2-yl)-1,5,6,7-tetrahydrocyclopenta[d]pyrimidine-4-thione (PubChem CID 106477468) has the molecular formula C13H18N2S3 and a molecular weight of 298.50 g/mol. Its IUPAC name is 2-(5,6-dimethyl-1,4-dithian-2-yl)-1,5,6,7-tetrahydrocyclopenta[d]pyrimidine-4-thione.
| Compound Name | 2-(5,6-dimethyl-1,4-dithian-2-yl)-1,5,6,7-tetrahydrocyclopenta[d]pyrimidine-4-thione |
|---|---|
| PubChem CID | 106477468 |
| Molecular Formula | C13H18N2S3 |
| Molecular Weight | 298.50 g/mol |
| Exact Mass | 298.06 |
| IUPAC Name | 2-(5,6-dimethyl-1,4-dithian-2-yl)-1,5,6,7-tetrahydrocyclopenta[d]pyrimidine-4-thione |
| SMILES | CC1SCC(c2nc(=S)c3c([nH]2)CCC3)SC1C |
| InChI | InChI=1S/C13H18N2S3/c1-7-8(2)18-11(6-17-7)12-14-10-5-3-4-9(10)13(16)15-12/h7-8,11H,3-6H2,1-2H3,(H,14,15,16) |
| InChIKey | OTQRWGWLCVLWDQ-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.50 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|