C8H9F3N2OS — CID 106477610
6-(methoxymethyl)-2-(2,2,2-trifluoroethyl)-1H-pyrimidine-4-thione (PubChem CID 106477610) has the molecular formula C8H9F3N2OS and a molecular weight of 238.23 g/mol. Its IUPAC name is 6-(methoxymethyl)-2-(2,2,2-trifluoroethyl)-1H-pyrimidine-4-thione.
| Compound Name | 6-(methoxymethyl)-2-(2,2,2-trifluoroethyl)-1H-pyrimidine-4-thione |
|---|---|
| PubChem CID | 106477610 |
| Molecular Formula | C8H9F3N2OS |
| Molecular Weight | 238.23 g/mol |
| Exact Mass | 238.04 |
| IUPAC Name | 6-(methoxymethyl)-2-(2,2,2-trifluoroethyl)-1H-pyrimidine-4-thione |
| SMILES | COCc1cc(=S)nc(CC(F)(F)F)[nH]1 |
| InChI | InChI=1S/C8H9F3N2OS/c1-14-4-5-2-7(15)13-6(12-5)3-8(9,10)11/h2H,3-4H2,1H3,(H,12,13,15) |
| InChIKey | NGDJYPIHXLNISO-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 37.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.23 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|