C12H18N2OS3 — CID 106477717
2-(5,6-dimethyl-1,4-dithian-2-yl)-6-(methoxymethyl)-1H-pyrimidine-4-thione (PubChem CID 106477717) has the molecular formula C12H18N2OS3 and a molecular weight of 302.49 g/mol. Its IUPAC name is 2-(5,6-dimethyl-1,4-dithian-2-yl)-6-(methoxymethyl)-1H-pyrimidine-4-thione.
| Compound Name | 2-(5,6-dimethyl-1,4-dithian-2-yl)-6-(methoxymethyl)-1H-pyrimidine-4-thione |
|---|---|
| PubChem CID | 106477717 |
| Molecular Formula | C12H18N2OS3 |
| Molecular Weight | 302.49 g/mol |
| Exact Mass | 302.06 |
| IUPAC Name | 2-(5,6-dimethyl-1,4-dithian-2-yl)-6-(methoxymethyl)-1H-pyrimidine-4-thione |
| SMILES | COCc1cc(=S)nc(C2CSC(C)C(C)S2)[nH]1 |
| InChI | InChI=1S/C12H18N2OS3/c1-7-8(2)18-10(6-17-7)12-13-9(5-15-3)4-11(16)14-12/h4,7-8,10H,5-6H2,1-3H3,(H,13,14,16) |
| InChIKey | HUTZGXXFCLFHNO-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 37.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.49 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|