C12H16N4S — CID 106477876
6-methyl-2-(3-methylimidazol-4-yl)-5-propan-2-yl-1H-pyrimidine-4-thione (PubChem CID 106477876) has the molecular formula C12H16N4S and a molecular weight of 248.35 g/mol. Its IUPAC name is 6-methyl-2-(3-methylimidazol-4-yl)-5-propan-2-yl-1H-pyrimidine-4-thione.
| Compound Name | 6-methyl-2-(3-methylimidazol-4-yl)-5-propan-2-yl-1H-pyrimidine-4-thione |
|---|---|
| PubChem CID | 106477876 |
| Molecular Formula | C12H16N4S |
| Molecular Weight | 248.35 g/mol |
| Exact Mass | 248.11 |
| IUPAC Name | 6-methyl-2-(3-methylimidazol-4-yl)-5-propan-2-yl-1H-pyrimidine-4-thione |
| SMILES | Cc1[nH]c(-c2cncn2C)nc(=S)c1C(C)C |
| InChI | InChI=1S/C12H16N4S/c1-7(2)10-8(3)14-11(15-12(10)17)9-5-13-6-16(9)4/h5-7H,1-4H3,(H,14,15,17) |
| InChIKey | WELDQGHGDYQLJM-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 46.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.35 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|