About 6-cyclopropyl-2-(1,4-dithian-2-yl)-1H-pyrimidine-4-thione
6-cyclopropyl-2-(1,4-dithian-2-yl)-1H-pyrimidine-4-thione (PubChem CID 106478579) has the molecular formula C11H14N2S3
and a molecular weight of 270.45 g/mol. Its IUPAC name is 6-cyclopropyl-2-(1,4-dithian-2-yl)-1H-pyrimidine-4-thione.
Molecular Properties
| Compound Name | 6-cyclopropyl-2-(1,4-dithian-2-yl)-1H-pyrimidine-4-thione |
| PubChem CID | 106478579 |
| Molecular Formula | C11H14N2S3 |
| Molecular Weight | 270.45 g/mol |
| Exact Mass | 270.03 |
| IUPAC Name | 6-cyclopropyl-2-(1,4-dithian-2-yl)-1H-pyrimidine-4-thione |
| SMILES | S=c1cc(C2CC2)[nH]c(C2CSCCS2)n1 |
| InChI | InChI=1S/C11H14N2S3/c14-10-5-8(7-1-2-7)12-11(13-10)9-6-15-3-4-16-9/h5,7,9H,1-4,6H2,(H,12,13,14) |
| InChIKey | VEMOUOXNZQQKOW-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 270.45 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 6-cyclopropyl-2-(1,4-dithian-2-yl)-1H-pyrimidine-4-thione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-cyclopropyl-2-(1,4-dithian-2-yl)-1H-pyrimidine-4-thione?
The IUPAC name of 6-cyclopropyl-2-(1,4-dithian-2-yl)-1H-pyrimidine-4-thione (CID 106478579) is 6-cyclopropyl-2-(1,4-dithian-2-yl)-1H-pyrimidine-4-thione.
What is the SMILES notation for 6-cyclopropyl-2-(1,4-dithian-2-yl)-1H-pyrimidine-4-thione?
The canonical SMILES for 6-cyclopropyl-2-(1,4-dithian-2-yl)-1H-pyrimidine-4-thione is S=c1cc(C2CC2)[nH]c(C2CSCCS2)n1.
What is the InChIKey of 6-cyclopropyl-2-(1,4-dithian-2-yl)-1H-pyrimidine-4-thione?
The InChIKey is VEMOUOXNZQQKOW-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14N2S3/c14-10-5-8(7-1-2-7)12-11(13-10)9-6-15-3-4-16-9/h5,7,9H,1-4,6H2,(H,12,13,14).
What are the key properties of 6-cyclopropyl-2-(1,4-dithian-2-yl)-1H-pyrimidine-4-thione?
6-cyclopropyl-2-(1,4-dithian-2-yl)-1H-pyrimidine-4-thione has a molecular weight of 270.45 g/mol, XLogP of 3.54, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-cyclopropyl-2-(1,4-dithian-2-yl)-1H-pyrimidine-4-thione is sourced from PubChem (CID 106478579), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).