C15H24N4S — CID 106478683
2-(1,4-dimethylpiperazin-2-yl)-1,5,6,7,8,9-hexahydrocyclohepta[d]pyrimidine-4-thione (PubChem CID 106478683) has the molecular formula C15H24N4S and a molecular weight of 292.45 g/mol. Its IUPAC name is 2-(1,4-dimethylpiperazin-2-yl)-1,5,6,7,8,9-hexahydrocyclohepta[d]pyrimidine-4-thione.
| Compound Name | 2-(1,4-dimethylpiperazin-2-yl)-1,5,6,7,8,9-hexahydrocyclohepta[d]pyrimidine-4-thione |
|---|---|
| PubChem CID | 106478683 |
| Molecular Formula | C15H24N4S |
| Molecular Weight | 292.45 g/mol |
| Exact Mass | 292.17 |
| IUPAC Name | 2-(1,4-dimethylpiperazin-2-yl)-1,5,6,7,8,9-hexahydrocyclohepta[d]pyrimidine-4-thione |
| SMILES | CN1CCN(C)C(c2nc(=S)c3c([nH]2)CCCCC3)C1 |
| InChI | InChI=1S/C15H24N4S/c1-18-8-9-19(2)13(10-18)14-16-12-7-5-3-4-6-11(12)15(20)17-14/h13H,3-10H2,1-2H3,(H,16,17,20) |
| InChIKey | GIXMTYRWCLBKSG-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 35.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.45 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|