C13H21N3S — CID 106478735
2-(diethylamino)-1,5,6,7,8,9-hexahydrocyclohepta[d]pyrimidine-4-thione (PubChem CID 106478735) has the molecular formula C13H21N3S and a molecular weight of 251.40 g/mol. Its IUPAC name is 2-(diethylamino)-1,5,6,7,8,9-hexahydrocyclohepta[d]pyrimidine-4-thione.
| Compound Name | 2-(diethylamino)-1,5,6,7,8,9-hexahydrocyclohepta[d]pyrimidine-4-thione |
|---|---|
| PubChem CID | 106478735 |
| Molecular Formula | C13H21N3S |
| Molecular Weight | 251.40 g/mol |
| Exact Mass | 251.15 |
| IUPAC Name | 2-(diethylamino)-1,5,6,7,8,9-hexahydrocyclohepta[d]pyrimidine-4-thione |
| SMILES | CCN(CC)c1nc(=S)c2c([nH]1)CCCCC2 |
| InChI | InChI=1S/C13H21N3S/c1-3-16(4-2)13-14-11-9-7-5-6-8-10(11)12(17)15-13/h3-9H2,1-2H3,(H,14,15,17) |
| InChIKey | YQNSQUALJRHJHB-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 31.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.40 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|