C14H21N3OS — CID 106478746
2-(4-methylmorpholin-2-yl)-1,5,6,7,8,9-hexahydrocyclohepta[d]pyrimidine-4-thione (PubChem CID 106478746) has the molecular formula C14H21N3OS and a molecular weight of 279.41 g/mol. Its IUPAC name is 2-(4-methylmorpholin-2-yl)-1,5,6,7,8,9-hexahydrocyclohepta[d]pyrimidine-4-thione.
| Compound Name | 2-(4-methylmorpholin-2-yl)-1,5,6,7,8,9-hexahydrocyclohepta[d]pyrimidine-4-thione |
|---|---|
| PubChem CID | 106478746 |
| Molecular Formula | C14H21N3OS |
| Molecular Weight | 279.41 g/mol |
| Exact Mass | 279.14 |
| IUPAC Name | 2-(4-methylmorpholin-2-yl)-1,5,6,7,8,9-hexahydrocyclohepta[d]pyrimidine-4-thione |
| SMILES | CN1CCOC(c2nc(=S)c3c([nH]2)CCCCC3)C1 |
| InChI | InChI=1S/C14H21N3OS/c1-17-7-8-18-12(9-17)13-15-11-6-4-2-3-5-10(11)14(19)16-13/h12H,2-9H2,1H3,(H,15,16,19) |
| InChIKey | WXUGFXUFFJXYFY-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 41.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.41 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|