C14H22N2S2 — CID 106478817
2-(butan-2-ylsulfanylmethyl)-1,5,6,7,8,9-hexahydrocyclohepta[d]pyrimidine-4-thione (PubChem CID 106478817) has the molecular formula C14H22N2S2 and a molecular weight of 282.48 g/mol. Its IUPAC name is 2-(butan-2-ylsulfanylmethyl)-1,5,6,7,8,9-hexahydrocyclohepta[d]pyrimidine-4-thione.
| Compound Name | 2-(butan-2-ylsulfanylmethyl)-1,5,6,7,8,9-hexahydrocyclohepta[d]pyrimidine-4-thione |
|---|---|
| PubChem CID | 106478817 |
| Molecular Formula | C14H22N2S2 |
| Molecular Weight | 282.48 g/mol |
| Exact Mass | 282.12 |
| IUPAC Name | 2-(butan-2-ylsulfanylmethyl)-1,5,6,7,8,9-hexahydrocyclohepta[d]pyrimidine-4-thione |
| SMILES | CCC(C)SCc1nc(=S)c2c([nH]1)CCCCC2 |
| InChI | InChI=1S/C14H22N2S2/c1-3-10(2)18-9-13-15-12-8-6-4-5-7-11(12)14(17)16-13/h10H,3-9H2,1-2H3,(H,15,16,17) |
| InChIKey | UMLKKNWLZBCKHK-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.48 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|