C9H11BrF2N2OS — CID 106479030
5-bromo-2-[2-(2,2-difluoroethoxy)ethyl]-6-methyl-1H-pyrimidine-4-thione (PubChem CID 106479030) has the molecular formula C9H11BrF2N2OS and a molecular weight of 313.17 g/mol. Its IUPAC name is 5-bromo-2-[2-(2,2-difluoroethoxy)ethyl]-6-methyl-1H-pyrimidine-4-thione.
| Compound Name | 5-bromo-2-[2-(2,2-difluoroethoxy)ethyl]-6-methyl-1H-pyrimidine-4-thione |
|---|---|
| PubChem CID | 106479030 |
| Molecular Formula | C9H11BrF2N2OS |
| Molecular Weight | 313.17 g/mol |
| Exact Mass | 311.97 |
| IUPAC Name | 5-bromo-2-[2-(2,2-difluoroethoxy)ethyl]-6-methyl-1H-pyrimidine-4-thione |
| SMILES | Cc1[nH]c(CCOCC(F)F)nc(=S)c1Br |
| InChI | InChI=1S/C9H11BrF2N2OS/c1-5-8(10)9(16)14-7(13-5)2-3-15-4-6(11)12/h6H,2-4H2,1H3,(H,13,14,16) |
| InChIKey | DVZPHEDNFOIEBO-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 37.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.17 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|