C7H9BrN2O2S2 — CID 106479062
5-bromo-6-methyl-2-(methylsulfonylmethyl)-1H-pyrimidine-4-thione (PubChem CID 106479062) has the molecular formula C7H9BrN2O2S2 and a molecular weight of 297.20 g/mol. Its IUPAC name is 5-bromo-6-methyl-2-(methylsulfonylmethyl)-1H-pyrimidine-4-thione.
| Compound Name | 5-bromo-6-methyl-2-(methylsulfonylmethyl)-1H-pyrimidine-4-thione |
|---|---|
| PubChem CID | 106479062 |
| Molecular Formula | C7H9BrN2O2S2 |
| Molecular Weight | 297.20 g/mol |
| Exact Mass | 295.93 |
| IUPAC Name | 5-bromo-6-methyl-2-(methylsulfonylmethyl)-1H-pyrimidine-4-thione |
| SMILES | Cc1[nH]c(CS(C)(=O)=O)nc(=S)c1Br |
| InChI | InChI=1S/C7H9BrN2O2S2/c1-4-6(8)7(13)10-5(9-4)3-14(2,11)12/h3H2,1-2H3,(H,9,10,13) |
| InChIKey | MCRFBTMNEGVKPG-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 62.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.20 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|