C10H13BrN2OS — CID 106479227
5-bromo-6-methyl-2-(oxolan-3-ylmethyl)-1H-pyrimidine-4-thione (PubChem CID 106479227) has the molecular formula C10H13BrN2OS and a molecular weight of 289.20 g/mol. Its IUPAC name is 5-bromo-6-methyl-2-(oxolan-3-ylmethyl)-1H-pyrimidine-4-thione.
| Compound Name | 5-bromo-6-methyl-2-(oxolan-3-ylmethyl)-1H-pyrimidine-4-thione |
|---|---|
| PubChem CID | 106479227 |
| Molecular Formula | C10H13BrN2OS |
| Molecular Weight | 289.20 g/mol |
| Exact Mass | 287.99 |
| IUPAC Name | 5-bromo-6-methyl-2-(oxolan-3-ylmethyl)-1H-pyrimidine-4-thione |
| SMILES | Cc1[nH]c(CC2CCOC2)nc(=S)c1Br |
| InChI | InChI=1S/C10H13BrN2OS/c1-6-9(11)10(15)13-8(12-6)4-7-2-3-14-5-7/h7H,2-5H2,1H3,(H,12,13,15) |
| InChIKey | CJFPMGHIMYVMGU-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 37.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.20 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|