C14H23BrN4S — CID 106479585
5-bromo-6-tert-butyl-2-(1,4-dimethylpiperazin-2-yl)-1H-pyrimidine-4-thione (PubChem CID 106479585) has the molecular formula C14H23BrN4S and a molecular weight of 359.34 g/mol. Its IUPAC name is 5-bromo-6-tert-butyl-2-(1,4-dimethylpiperazin-2-yl)-1H-pyrimidine-4-thione.
| Compound Name | 5-bromo-6-tert-butyl-2-(1,4-dimethylpiperazin-2-yl)-1H-pyrimidine-4-thione |
|---|---|
| PubChem CID | 106479585 |
| Molecular Formula | C14H23BrN4S |
| Molecular Weight | 359.34 g/mol |
| Exact Mass | 358.08 |
| IUPAC Name | 5-bromo-6-tert-butyl-2-(1,4-dimethylpiperazin-2-yl)-1H-pyrimidine-4-thione |
| SMILES | CN1CCN(C)C(c2nc(=S)c(Br)c(C(C)(C)C)[nH]2)C1 |
| InChI | InChI=1S/C14H23BrN4S/c1-14(2,3)11-10(15)13(20)17-12(16-11)9-8-18(4)6-7-19(9)5/h9H,6-8H2,1-5H3,(H,16,17,20) |
| InChIKey | PFAHGFYIONXXGY-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 35.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.34 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|