C14H24BrN3S — CID 106479597
5-bromo-6-tert-butyl-2-[2-(diethylamino)ethyl]-1H-pyrimidine-4-thione (PubChem CID 106479597) has the molecular formula C14H24BrN3S and a molecular weight of 346.34 g/mol. Its IUPAC name is 5-bromo-6-tert-butyl-2-[2-(diethylamino)ethyl]-1H-pyrimidine-4-thione.
| Compound Name | 5-bromo-6-tert-butyl-2-[2-(diethylamino)ethyl]-1H-pyrimidine-4-thione |
|---|---|
| PubChem CID | 106479597 |
| Molecular Formula | C14H24BrN3S |
| Molecular Weight | 346.34 g/mol |
| Exact Mass | 345.09 |
| IUPAC Name | 5-bromo-6-tert-butyl-2-[2-(diethylamino)ethyl]-1H-pyrimidine-4-thione |
| SMILES | CCN(CC)CCc1nc(=S)c(Br)c(C(C)(C)C)[nH]1 |
| InChI | InChI=1S/C14H24BrN3S/c1-6-18(7-2)9-8-10-16-12(14(3,4)5)11(15)13(19)17-10/h6-9H2,1-5H3,(H,16,17,19) |
| InChIKey | FLGUKVOUOTXTKH-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 31.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.34 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|