C15H25BrN4S — CID 106479658
5-bromo-6-tert-butyl-2-[(1,4-dimethylpiperazin-2-yl)methyl]-1H-pyrimidine-4-thione (PubChem CID 106479658) has the molecular formula C15H25BrN4S and a molecular weight of 373.36 g/mol. Its IUPAC name is 5-bromo-6-tert-butyl-2-[(1,4-dimethylpiperazin-2-yl)methyl]-1H-pyrimidine-4-thione.
| Compound Name | 5-bromo-6-tert-butyl-2-[(1,4-dimethylpiperazin-2-yl)methyl]-1H-pyrimidine-4-thione |
|---|---|
| PubChem CID | 106479658 |
| Molecular Formula | C15H25BrN4S |
| Molecular Weight | 373.36 g/mol |
| Exact Mass | 372.10 |
| IUPAC Name | 5-bromo-6-tert-butyl-2-[(1,4-dimethylpiperazin-2-yl)methyl]-1H-pyrimidine-4-thione |
| SMILES | CN1CCN(C)C(Cc2nc(=S)c(Br)c(C(C)(C)C)[nH]2)C1 |
| InChI | InChI=1S/C15H25BrN4S/c1-15(2,3)13-12(16)14(21)18-11(17-13)8-10-9-19(4)6-7-20(10)5/h10H,6-9H2,1-5H3,(H,17,18,21) |
| InChIKey | XOAHCCZYACQLGO-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 35.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.36 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|