C22H22BrN5O2 — CID 10647970
13-bromo-2-ethyl-5-[(4-methoxyphenyl)methylamino]-9-methyl-2,4,9,15-tetrazatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaen-10-one (PubChem CID 10647970) has the molecular formula C22H22BrN5O2 and a molecular weight of 468.36 g/mol. Its IUPAC name is 13-bromo-2-ethyl-5-[(4-methoxyphenyl)methylamino]-9-methyl-2,4,9,15-tetrazatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaen-10-one.
| Compound Name | 13-bromo-2-ethyl-5-[(4-methoxyphenyl)methylamino]-9-methyl-2,4,9,15-tetrazatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaen-10-one |
|---|---|
| PubChem CID | 10647970 |
| Molecular Formula | C22H22BrN5O2 |
| Molecular Weight | 468.36 g/mol |
| Exact Mass | 467.10 |
| IUPAC Name | 13-bromo-2-ethyl-5-[(4-methoxyphenyl)methylamino]-9-methyl-2,4,9,15-tetrazatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaen-10-one |
| SMILES | CCN1c2ncc(Br)cc2C(=O)N(C)c2ccc(NCc3ccc(OC)cc3)nc21 |
| InChI | InChI=1S/C22H22BrN5O2/c1-4-28-20-17(11-15(23)13-25-20)22(29)27(2)18-9-10-19(26-21(18)28)24-12-14-5-7-16(30-3)8-6-14/h5-11,13H,4,12H2,1-3H3,(H,24,26) |
| InChIKey | CHBCHILLPIXMOE-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.36 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |