C13H21BrN4S — CID 106480087
5-bromo-2-(1,4-dimethylpiperazin-2-yl)-6-propan-2-yl-1H-pyrimidine-4-thione (PubChem CID 106480087) has the molecular formula C13H21BrN4S and a molecular weight of 345.31 g/mol. Its IUPAC name is 5-bromo-2-(1,4-dimethylpiperazin-2-yl)-6-propan-2-yl-1H-pyrimidine-4-thione.
| Compound Name | 5-bromo-2-(1,4-dimethylpiperazin-2-yl)-6-propan-2-yl-1H-pyrimidine-4-thione |
|---|---|
| PubChem CID | 106480087 |
| Molecular Formula | C13H21BrN4S |
| Molecular Weight | 345.31 g/mol |
| Exact Mass | 344.07 |
| IUPAC Name | 5-bromo-2-(1,4-dimethylpiperazin-2-yl)-6-propan-2-yl-1H-pyrimidine-4-thione |
| SMILES | CC(C)c1[nH]c(C2CN(C)CCN2C)nc(=S)c1Br |
| InChI | InChI=1S/C13H21BrN4S/c1-8(2)11-10(14)13(19)16-12(15-11)9-7-17(3)5-6-18(9)4/h8-9H,5-7H2,1-4H3,(H,15,16,19) |
| InChIKey | XQPBKECVZNDRBO-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 35.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.31 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|