C12H19BrN2S2 — CID 106480116
5-bromo-2-(tert-butylsulfanylmethyl)-6-propan-2-yl-1H-pyrimidine-4-thione (PubChem CID 106480116) has the molecular formula C12H19BrN2S2 and a molecular weight of 335.34 g/mol. Its IUPAC name is 5-bromo-2-(tert-butylsulfanylmethyl)-6-propan-2-yl-1H-pyrimidine-4-thione.
| Compound Name | 5-bromo-2-(tert-butylsulfanylmethyl)-6-propan-2-yl-1H-pyrimidine-4-thione |
|---|---|
| PubChem CID | 106480116 |
| Molecular Formula | C12H19BrN2S2 |
| Molecular Weight | 335.34 g/mol |
| Exact Mass | 334.02 |
| IUPAC Name | 5-bromo-2-(tert-butylsulfanylmethyl)-6-propan-2-yl-1H-pyrimidine-4-thione |
| SMILES | CC(C)c1[nH]c(CSC(C)(C)C)nc(=S)c1Br |
| InChI | InChI=1S/C12H19BrN2S2/c1-7(2)10-9(13)11(16)15-8(14-10)6-17-12(3,4)5/h7H,6H2,1-5H3,(H,14,15,16) |
| InChIKey | VRKAZWFLNXNIIQ-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.34 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|