C14H23BrN4S — CID 106480165
5-bromo-2-[(1,4-dimethylpiperazin-2-yl)methyl]-6-propan-2-yl-1H-pyrimidine-4-thione (PubChem CID 106480165) has the molecular formula C14H23BrN4S and a molecular weight of 359.34 g/mol. Its IUPAC name is 5-bromo-2-[(1,4-dimethylpiperazin-2-yl)methyl]-6-propan-2-yl-1H-pyrimidine-4-thione.
| Compound Name | 5-bromo-2-[(1,4-dimethylpiperazin-2-yl)methyl]-6-propan-2-yl-1H-pyrimidine-4-thione |
|---|---|
| PubChem CID | 106480165 |
| Molecular Formula | C14H23BrN4S |
| Molecular Weight | 359.34 g/mol |
| Exact Mass | 358.08 |
| IUPAC Name | 5-bromo-2-[(1,4-dimethylpiperazin-2-yl)methyl]-6-propan-2-yl-1H-pyrimidine-4-thione |
| SMILES | CC(C)c1[nH]c(CC2CN(C)CCN2C)nc(=S)c1Br |
| InChI | InChI=1S/C14H23BrN4S/c1-9(2)13-12(15)14(20)17-11(16-13)7-10-8-18(3)5-6-19(10)4/h9-10H,5-8H2,1-4H3,(H,16,17,20) |
| InChIKey | YIQZMORBOFSTLW-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 35.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.34 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|