C14H21BrN4S — CID 106480423
5-bromo-6-cyclopropyl-2-[(1,4-dimethylpiperazin-2-yl)methyl]-1H-pyrimidine-4-thione (PubChem CID 106480423) has the molecular formula C14H21BrN4S and a molecular weight of 357.32 g/mol. Its IUPAC name is 5-bromo-6-cyclopropyl-2-[(1,4-dimethylpiperazin-2-yl)methyl]-1H-pyrimidine-4-thione.
| Compound Name | 5-bromo-6-cyclopropyl-2-[(1,4-dimethylpiperazin-2-yl)methyl]-1H-pyrimidine-4-thione |
|---|---|
| PubChem CID | 106480423 |
| Molecular Formula | C14H21BrN4S |
| Molecular Weight | 357.32 g/mol |
| Exact Mass | 356.07 |
| IUPAC Name | 5-bromo-6-cyclopropyl-2-[(1,4-dimethylpiperazin-2-yl)methyl]-1H-pyrimidine-4-thione |
| SMILES | CN1CCN(C)C(Cc2nc(=S)c(Br)c(C3CC3)[nH]2)C1 |
| InChI | InChI=1S/C14H21BrN4S/c1-18-5-6-19(2)10(8-18)7-11-16-13(9-3-4-9)12(15)14(20)17-11/h9-10H,3-8H2,1-2H3,(H,16,17,20) |
| InChIKey | QSFYEUVSYYYVPZ-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 35.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.32 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|