About 5-bromo-2-(3-ethyl-1,4-dithian-2-yl)-6-(methoxymethyl)-1H-pyrimidine-4-thione
5-bromo-2-(3-ethyl-1,4-dithian-2-yl)-6-(methoxymethyl)-1H-pyrimidine-4-thione (PubChem CID 106480523) has the molecular formula C12H17BrN2OS3
and a molecular weight of 381.39 g/mol. Its IUPAC name is 5-bromo-2-(3-ethyl-1,4-dithian-2-yl)-6-(methoxymethyl)-1H-pyrimidine-4-thione.
Molecular Properties
| Compound Name | 5-bromo-2-(3-ethyl-1,4-dithian-2-yl)-6-(methoxymethyl)-1H-pyrimidine-4-thione |
| PubChem CID | 106480523 |
| Molecular Formula | C12H17BrN2OS3 |
| Molecular Weight | 381.39 g/mol |
| Exact Mass | 379.97 |
| IUPAC Name | 5-bromo-2-(3-ethyl-1,4-dithian-2-yl)-6-(methoxymethyl)-1H-pyrimidine-4-thione |
| SMILES | CCC1SCCSC1c1nc(=S)c(Br)c(COC)[nH]1 |
| InChI | InChI=1S/C12H17BrN2OS3/c1-3-8-10(19-5-4-18-8)11-14-7(6-16-2)9(13)12(17)15-11/h8,10H,3-6H2,1-2H3,(H,14,15,17) |
| InChIKey | HZYIHMOJHKFZRV-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 37.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 381.39 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 5-bromo-2-(3-ethyl-1,4-dithian-2-yl)-6-(methoxymethyl)-1H-pyrimidine-4-thione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-bromo-2-(3-ethyl-1,4-dithian-2-yl)-6-(methoxymethyl)-1H-pyrimidine-4-thione?
The IUPAC name of 5-bromo-2-(3-ethyl-1,4-dithian-2-yl)-6-(methoxymethyl)-1H-pyrimidine-4-thione (CID 106480523) is 5-bromo-2-(3-ethyl-1,4-dithian-2-yl)-6-(methoxymethyl)-1H-pyrimidine-4-thione.
What is the SMILES notation for 5-bromo-2-(3-ethyl-1,4-dithian-2-yl)-6-(methoxymethyl)-1H-pyrimidine-4-thione?
The canonical SMILES for 5-bromo-2-(3-ethyl-1,4-dithian-2-yl)-6-(methoxymethyl)-1H-pyrimidine-4-thione is CCC1SCCSC1c1nc(=S)c(Br)c(COC)[nH]1.
What is the InChIKey of 5-bromo-2-(3-ethyl-1,4-dithian-2-yl)-6-(methoxymethyl)-1H-pyrimidine-4-thione?
The InChIKey is HZYIHMOJHKFZRV-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H17BrN2OS3/c1-3-8-10(19-5-4-18-8)11-14-7(6-16-2)9(13)12(17)15-11/h8,10H,3-6H2,1-2H3,(H,14,15,17).
What are the key properties of 5-bromo-2-(3-ethyl-1,4-dithian-2-yl)-6-(methoxymethyl)-1H-pyrimidine-4-thione?
5-bromo-2-(3-ethyl-1,4-dithian-2-yl)-6-(methoxymethyl)-1H-pyrimidine-4-thione has a molecular weight of 381.39 g/mol, XLogP of 4.35, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-bromo-2-(3-ethyl-1,4-dithian-2-yl)-6-(methoxymethyl)-1H-pyrimidine-4-thione is sourced from PubChem (CID 106480523), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).