C9H13BrN2O3S2 — CID 106480604
5-bromo-6-(methoxymethyl)-2-(1-methylsulfonylethyl)-1H-pyrimidine-4-thione (PubChem CID 106480604) has the molecular formula C9H13BrN2O3S2 and a molecular weight of 341.25 g/mol. Its IUPAC name is 5-bromo-6-(methoxymethyl)-2-(1-methylsulfonylethyl)-1H-pyrimidine-4-thione.
| Compound Name | 5-bromo-6-(methoxymethyl)-2-(1-methylsulfonylethyl)-1H-pyrimidine-4-thione |
|---|---|
| PubChem CID | 106480604 |
| Molecular Formula | C9H13BrN2O3S2 |
| Molecular Weight | 341.25 g/mol |
| Exact Mass | 339.96 |
| IUPAC Name | 5-bromo-6-(methoxymethyl)-2-(1-methylsulfonylethyl)-1H-pyrimidine-4-thione |
| SMILES | COCc1[nH]c(C(C)S(C)(=O)=O)nc(=S)c1Br |
| InChI | InChI=1S/C9H13BrN2O3S2/c1-5(17(3,13)14)8-11-6(4-15-2)7(10)9(16)12-8/h5H,4H2,1-3H3,(H,11,12,16) |
| InChIKey | XUORVZLURVAKIS-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 72.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.25 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|