C10H11BrF4N2O2S — CID 106480608
5-bromo-6-(methoxymethyl)-2-(2,2,3,3-tetrafluoropropoxymethyl)-1H-pyrimidine-4-thione (PubChem CID 106480608) has the molecular formula C10H11BrF4N2O2S and a molecular weight of 379.17 g/mol. Its IUPAC name is 5-bromo-6-(methoxymethyl)-2-(2,2,3,3-tetrafluoropropoxymethyl)-1H-pyrimidine-4-thione.
| Compound Name | 5-bromo-6-(methoxymethyl)-2-(2,2,3,3-tetrafluoropropoxymethyl)-1H-pyrimidine-4-thione |
|---|---|
| PubChem CID | 106480608 |
| Molecular Formula | C10H11BrF4N2O2S |
| Molecular Weight | 379.17 g/mol |
| Exact Mass | 377.97 |
| IUPAC Name | 5-bromo-6-(methoxymethyl)-2-(2,2,3,3-tetrafluoropropoxymethyl)-1H-pyrimidine-4-thione |
| SMILES | COCc1[nH]c(COCC(F)(F)C(F)F)nc(=S)c1Br |
| InChI | InChI=1S/C10H11BrF4N2O2S/c1-18-2-5-7(11)8(20)17-6(16-5)3-19-4-10(14,15)9(12)13/h9H,2-4H2,1H3,(H,16,17,20) |
| InChIKey | LFSSLXZCWVWRBT-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 47.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.17 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|