About 5-bromo-2-[(2,6-dichlorophenyl)methyl]-6-(methoxymethyl)-1H-pyrimidine-4-thione
5-bromo-2-[(2,6-dichlorophenyl)methyl]-6-(methoxymethyl)-1H-pyrimidine-4-thione (PubChem CID 106480618) has the molecular formula C13H11BrCl2N2OS
and a molecular weight of 394.12 g/mol. Its IUPAC name is 5-bromo-2-[(2,6-dichlorophenyl)methyl]-6-(methoxymethyl)-1H-pyrimidine-4-thione.
Molecular Properties
| Compound Name | 5-bromo-2-[(2,6-dichlorophenyl)methyl]-6-(methoxymethyl)-1H-pyrimidine-4-thione |
| PubChem CID | 106480618 |
| Molecular Formula | C13H11BrCl2N2OS |
| Molecular Weight | 394.12 g/mol |
| Exact Mass | 391.92 |
| IUPAC Name | 5-bromo-2-[(2,6-dichlorophenyl)methyl]-6-(methoxymethyl)-1H-pyrimidine-4-thione |
| SMILES | COCc1[nH]c(Cc2c(Cl)cccc2Cl)nc(=S)c1Br |
| InChI | InChI=1S/C13H11BrCl2N2OS/c1-19-6-10-12(14)13(20)18-11(17-10)5-7-8(15)3-2-4-9(7)16/h2-4H,5-6H2,1H3,(H,17,18,20) |
| InChIKey | KEXRSFOTVKDZNG-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 37.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 394.12 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 5-bromo-2-[(2,6-dichlorophenyl)methyl]-6-(methoxymethyl)-1H-pyrimidine-4-thione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-bromo-2-[(2,6-dichlorophenyl)methyl]-6-(methoxymethyl)-1H-pyrimidine-4-thione?
The IUPAC name of 5-bromo-2-[(2,6-dichlorophenyl)methyl]-6-(methoxymethyl)-1H-pyrimidine-4-thione (CID 106480618) is 5-bromo-2-[(2,6-dichlorophenyl)methyl]-6-(methoxymethyl)-1H-pyrimidine-4-thione.
What is the SMILES notation for 5-bromo-2-[(2,6-dichlorophenyl)methyl]-6-(methoxymethyl)-1H-pyrimidine-4-thione?
The canonical SMILES for 5-bromo-2-[(2,6-dichlorophenyl)methyl]-6-(methoxymethyl)-1H-pyrimidine-4-thione is COCc1[nH]c(Cc2c(Cl)cccc2Cl)nc(=S)c1Br.
What is the InChIKey of 5-bromo-2-[(2,6-dichlorophenyl)methyl]-6-(methoxymethyl)-1H-pyrimidine-4-thione?
The InChIKey is KEXRSFOTVKDZNG-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H11BrCl2N2OS/c1-19-6-10-12(14)13(20)18-11(17-10)5-7-8(15)3-2-4-9(7)16/h2-4H,5-6H2,1H3,(H,17,18,20).
What are the key properties of 5-bromo-2-[(2,6-dichlorophenyl)methyl]-6-(methoxymethyl)-1H-pyrimidine-4-thione?
5-bromo-2-[(2,6-dichlorophenyl)methyl]-6-(methoxymethyl)-1H-pyrimidine-4-thione has a molecular weight of 394.12 g/mol, XLogP of 4.95, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-bromo-2-[(2,6-dichlorophenyl)methyl]-6-(methoxymethyl)-1H-pyrimidine-4-thione is sourced from PubChem (CID 106480618), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).