About 5-bromo-2-(1,4-dithian-2-yl)-6-(methoxymethyl)-1H-pyrimidine-4-thione
5-bromo-2-(1,4-dithian-2-yl)-6-(methoxymethyl)-1H-pyrimidine-4-thione (PubChem CID 106480752) has the molecular formula C10H13BrN2OS3
and a molecular weight of 353.33 g/mol. Its IUPAC name is 5-bromo-2-(1,4-dithian-2-yl)-6-(methoxymethyl)-1H-pyrimidine-4-thione.
Molecular Properties
| Compound Name | 5-bromo-2-(1,4-dithian-2-yl)-6-(methoxymethyl)-1H-pyrimidine-4-thione |
| PubChem CID | 106480752 |
| Molecular Formula | C10H13BrN2OS3 |
| Molecular Weight | 353.33 g/mol |
| Exact Mass | 351.94 |
| IUPAC Name | 5-bromo-2-(1,4-dithian-2-yl)-6-(methoxymethyl)-1H-pyrimidine-4-thione |
| SMILES | COCc1[nH]c(C2CSCCS2)nc(=S)c1Br |
| InChI | InChI=1S/C10H13BrN2OS3/c1-14-4-6-8(11)10(15)13-9(12-6)7-5-16-2-3-17-7/h7H,2-5H2,1H3,(H,12,13,15) |
| InChIKey | PDDVSQRQJIAFGI-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 37.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 353.33 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 5-bromo-2-(1,4-dithian-2-yl)-6-(methoxymethyl)-1H-pyrimidine-4-thione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-bromo-2-(1,4-dithian-2-yl)-6-(methoxymethyl)-1H-pyrimidine-4-thione?
The IUPAC name of 5-bromo-2-(1,4-dithian-2-yl)-6-(methoxymethyl)-1H-pyrimidine-4-thione (CID 106480752) is 5-bromo-2-(1,4-dithian-2-yl)-6-(methoxymethyl)-1H-pyrimidine-4-thione.
What is the SMILES notation for 5-bromo-2-(1,4-dithian-2-yl)-6-(methoxymethyl)-1H-pyrimidine-4-thione?
The canonical SMILES for 5-bromo-2-(1,4-dithian-2-yl)-6-(methoxymethyl)-1H-pyrimidine-4-thione is COCc1[nH]c(C2CSCCS2)nc(=S)c1Br.
What is the InChIKey of 5-bromo-2-(1,4-dithian-2-yl)-6-(methoxymethyl)-1H-pyrimidine-4-thione?
The InChIKey is PDDVSQRQJIAFGI-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13BrN2OS3/c1-14-4-6-8(11)10(15)13-9(12-6)7-5-16-2-3-17-7/h7H,2-5H2,1H3,(H,12,13,15).
What are the key properties of 5-bromo-2-(1,4-dithian-2-yl)-6-(methoxymethyl)-1H-pyrimidine-4-thione?
5-bromo-2-(1,4-dithian-2-yl)-6-(methoxymethyl)-1H-pyrimidine-4-thione has a molecular weight of 353.33 g/mol, XLogP of 3.57, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-bromo-2-(1,4-dithian-2-yl)-6-(methoxymethyl)-1H-pyrimidine-4-thione is sourced from PubChem (CID 106480752), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).