About 5-bromo-2-(3,5-dimethyl-1-adamantyl)-1H-pyrimidine-6-thione
5-bromo-2-(3,5-dimethyl-1-adamantyl)-1H-pyrimidine-6-thione (PubChem CID 106480807) has the molecular formula C16H21BrN2S
and a molecular weight of 353.33 g/mol. Its IUPAC name is 5-bromo-2-(3,5-dimethyl-1-adamantyl)-1H-pyrimidine-6-thione.
Molecular Properties
| Compound Name | 5-bromo-2-(3,5-dimethyl-1-adamantyl)-1H-pyrimidine-6-thione |
| PubChem CID | 106480807 |
| Molecular Formula | C16H21BrN2S |
| Molecular Weight | 353.33 g/mol |
| Exact Mass | 352.06 |
| IUPAC Name | 5-bromo-2-(3,5-dimethyl-1-adamantyl)-1H-pyrimidine-6-thione |
| SMILES | CC12CC3CC(C)(C1)CC(c1ncc(Br)c(=S)[nH]1)(C3)C2 |
| InChI | InChI=1S/C16H21BrN2S/c1-14-3-10-4-15(2,7-14)9-16(5-10,8-14)13-18-6-11(17)12(20)19-13/h6,10H,3-5,7-9H2,1-2H3,(H,18,19,20) |
| InChIKey | WMTHRIBIADUXJR-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 353.33 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 5-bromo-2-(3,5-dimethyl-1-adamantyl)-1H-pyrimidine-6-thione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-bromo-2-(3,5-dimethyl-1-adamantyl)-1H-pyrimidine-6-thione?
The IUPAC name of 5-bromo-2-(3,5-dimethyl-1-adamantyl)-1H-pyrimidine-6-thione (CID 106480807) is 5-bromo-2-(3,5-dimethyl-1-adamantyl)-1H-pyrimidine-6-thione.
What is the SMILES notation for 5-bromo-2-(3,5-dimethyl-1-adamantyl)-1H-pyrimidine-6-thione?
The canonical SMILES for 5-bromo-2-(3,5-dimethyl-1-adamantyl)-1H-pyrimidine-6-thione is CC12CC3CC(C)(C1)CC(c1ncc(Br)c(=S)[nH]1)(C3)C2.
What is the InChIKey of 5-bromo-2-(3,5-dimethyl-1-adamantyl)-1H-pyrimidine-6-thione?
The InChIKey is WMTHRIBIADUXJR-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H21BrN2S/c1-14-3-10-4-15(2,7-14)9-16(5-10,8-14)13-18-6-11(17)12(20)19-13/h6,10H,3-5,7-9H2,1-2H3,(H,18,19,20).
What are the key properties of 5-bromo-2-(3,5-dimethyl-1-adamantyl)-1H-pyrimidine-6-thione?
5-bromo-2-(3,5-dimethyl-1-adamantyl)-1H-pyrimidine-6-thione has a molecular weight of 353.33 g/mol, XLogP of 5.15, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-bromo-2-(3,5-dimethyl-1-adamantyl)-1H-pyrimidine-6-thione is sourced from PubChem (CID 106480807), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).