About 5-bromo-2-[2-(2,2-difluoroethoxy)ethyl]-1H-pyrimidine-6-thione
5-bromo-2-[2-(2,2-difluoroethoxy)ethyl]-1H-pyrimidine-6-thione (PubChem CID 106480820) has the molecular formula C8H9BrF2N2OS
and a molecular weight of 299.14 g/mol. Its IUPAC name is 5-bromo-2-[2-(2,2-difluoroethoxy)ethyl]-1H-pyrimidine-6-thione.
Molecular Properties
| Compound Name | 5-bromo-2-[2-(2,2-difluoroethoxy)ethyl]-1H-pyrimidine-6-thione |
| PubChem CID | 106480820 |
| Molecular Formula | C8H9BrF2N2OS |
| Molecular Weight | 299.14 g/mol |
| Exact Mass | 297.96 |
| IUPAC Name | 5-bromo-2-[2-(2,2-difluoroethoxy)ethyl]-1H-pyrimidine-6-thione |
| SMILES | FC(F)COCCc1ncc(Br)c(=S)[nH]1 |
| InChI | InChI=1S/C8H9BrF2N2OS/c9-5-3-12-7(13-8(5)15)1-2-14-4-6(10)11/h3,6H,1-2,4H2,(H,12,13,15) |
| InChIKey | SHZUTHYRVQVMOS-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 37.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 299.14 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 5-bromo-2-[2-(2,2-difluoroethoxy)ethyl]-1H-pyrimidine-6-thione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-bromo-2-[2-(2,2-difluoroethoxy)ethyl]-1H-pyrimidine-6-thione?
The IUPAC name of 5-bromo-2-[2-(2,2-difluoroethoxy)ethyl]-1H-pyrimidine-6-thione (CID 106480820) is 5-bromo-2-[2-(2,2-difluoroethoxy)ethyl]-1H-pyrimidine-6-thione.
What is the SMILES notation for 5-bromo-2-[2-(2,2-difluoroethoxy)ethyl]-1H-pyrimidine-6-thione?
The canonical SMILES for 5-bromo-2-[2-(2,2-difluoroethoxy)ethyl]-1H-pyrimidine-6-thione is FC(F)COCCc1ncc(Br)c(=S)[nH]1.
What is the InChIKey of 5-bromo-2-[2-(2,2-difluoroethoxy)ethyl]-1H-pyrimidine-6-thione?
The InChIKey is SHZUTHYRVQVMOS-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9BrF2N2OS/c9-5-3-12-7(13-8(5)15)1-2-14-4-6(10)11/h3,6H,1-2,4H2,(H,12,13,15).
What are the key properties of 5-bromo-2-[2-(2,2-difluoroethoxy)ethyl]-1H-pyrimidine-6-thione?
5-bromo-2-[2-(2,2-difluoroethoxy)ethyl]-1H-pyrimidine-6-thione has a molecular weight of 299.14 g/mol, XLogP of 2.73, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-bromo-2-[2-(2,2-difluoroethoxy)ethyl]-1H-pyrimidine-6-thione is sourced from PubChem (CID 106480820), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).