C8H7BrF4N2OS — CID 106480878
5-bromo-2-(2,2,3,3-tetrafluoropropoxymethyl)-1H-pyrimidine-6-thione (PubChem CID 106480878) has the molecular formula C8H7BrF4N2OS and a molecular weight of 335.12 g/mol. Its IUPAC name is 5-bromo-2-(2,2,3,3-tetrafluoropropoxymethyl)-1H-pyrimidine-6-thione.
| Compound Name | 5-bromo-2-(2,2,3,3-tetrafluoropropoxymethyl)-1H-pyrimidine-6-thione |
|---|---|
| PubChem CID | 106480878 |
| Molecular Formula | C8H7BrF4N2OS |
| Molecular Weight | 335.12 g/mol |
| Exact Mass | 333.94 |
| IUPAC Name | 5-bromo-2-(2,2,3,3-tetrafluoropropoxymethyl)-1H-pyrimidine-6-thione |
| SMILES | FC(F)C(F)(F)COCc1ncc(Br)c(=S)[nH]1 |
| InChI | InChI=1S/C8H7BrF4N2OS/c9-4-1-14-5(15-6(4)17)2-16-3-8(12,13)7(10)11/h1,7H,2-3H2,(H,14,15,17) |
| InChIKey | IMOMXFSYCZAILK-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 37.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.12 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|