C23H29N5O4S — CID 10648089
(2R)-N'-hydroxy-N-[(2S)-3-(1H-indol-3-yl)-1-oxo-1-(1,3-thiazol-2-ylmethylamino)propan-2-yl]-2-(2-methylpropyl)butanediamide (PubChem CID 10648089) has the molecular formula C23H29N5O4S and a molecular weight of 471.58 g/mol. Its IUPAC name is (2R)-N'-hydroxy-N-[(2S)-3-(1H-indol-3-yl)-1-oxo-1-(1,3-thiazol-2-ylmethylamino)propan-2-yl]-2-(2-methylpropyl)butanediamide.
| Compound Name | (2R)-N'-hydroxy-N-[(2S)-3-(1H-indol-3-yl)-1-oxo-1-(1,3-thiazol-2-ylmethylamino)propan-2-yl]-2-(2-methylpropyl)butanediamide |
|---|---|
| PubChem CID | 10648089 |
| Molecular Formula | C23H29N5O4S |
| Molecular Weight | 471.58 g/mol |
| Exact Mass | 471.19 |
| IUPAC Name | (2R)-N'-hydroxy-N-[(2S)-3-(1H-indol-3-yl)-1-oxo-1-(1,3-thiazol-2-ylmethylamino)propan-2-yl]-2-(2-methylpropyl)butanediamide |
| SMILES | CC(C)C[C@H](CC(=O)NO)C(=O)N[C@@H](Cc1c[nH]c2ccccc12)C(=O)NCc1nccs1 |
| InChI | InChI=1S/C23H29N5O4S/c1-14(2)9-15(11-20(29)28-32)22(30)27-19(23(31)26-13-21-24-7-8-33-21)10-16-12-25-18-6-4-3-5-17(16)18/h3-8,12,14-15,19,25,32H,9-11,13H2,1-2H3,(H,26,31)(H,27,30)(H,28,29)/t15-,19+/m1/s1 |
| InChIKey | VXXBOZLJRUCYLE-BEFAXECRSA-N |
| XLogP | 2.53 |
| TPSA | 136.21 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.58 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|