C15H16BrClN2S — CID 106481200
5-bromo-2-[(4-chlorophenyl)methyl]-6-(2-methylpropyl)-1H-pyrimidine-4-thione (PubChem CID 106481200) has the molecular formula C15H16BrClN2S and a molecular weight of 371.73 g/mol. Its IUPAC name is 5-bromo-2-[(4-chlorophenyl)methyl]-6-(2-methylpropyl)-1H-pyrimidine-4-thione.
| Compound Name | 5-bromo-2-[(4-chlorophenyl)methyl]-6-(2-methylpropyl)-1H-pyrimidine-4-thione |
|---|---|
| PubChem CID | 106481200 |
| Molecular Formula | C15H16BrClN2S |
| Molecular Weight | 371.73 g/mol |
| Exact Mass | 369.99 |
| IUPAC Name | 5-bromo-2-[(4-chlorophenyl)methyl]-6-(2-methylpropyl)-1H-pyrimidine-4-thione |
| SMILES | CC(C)Cc1[nH]c(Cc2ccc(Cl)cc2)nc(=S)c1Br |
| InChI | InChI=1S/C15H16BrClN2S/c1-9(2)7-12-14(16)15(20)19-13(18-12)8-10-3-5-11(17)6-4-10/h3-6,9H,7-8H2,1-2H3,(H,18,19,20) |
| InChIKey | RSJWYLQJPXCNID-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.73 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|