C8H11N3S2 — CID 106481559
2-(dimethylamino)-5,7-dihydro-1H-thieno[3,4-d]pyrimidine-4-thione (PubChem CID 106481559) has the molecular formula C8H11N3S2 and a molecular weight of 213.33 g/mol. Its IUPAC name is 2-(dimethylamino)-5,7-dihydro-1H-thieno[3,4-d]pyrimidine-4-thione.
| Compound Name | 2-(dimethylamino)-5,7-dihydro-1H-thieno[3,4-d]pyrimidine-4-thione |
|---|---|
| PubChem CID | 106481559 |
| Molecular Formula | C8H11N3S2 |
| Molecular Weight | 213.33 g/mol |
| Exact Mass | 213.04 |
| IUPAC Name | 2-(dimethylamino)-5,7-dihydro-1H-thieno[3,4-d]pyrimidine-4-thione |
| SMILES | CN(C)c1nc(=S)c2c([nH]1)CSC2 |
| InChI | InChI=1S/C8H11N3S2/c1-11(2)8-9-6-4-13-3-5(6)7(12)10-8/h3-4H2,1-2H3,(H,9,10,12) |
| InChIKey | HAAVYKWTLBGWFL-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 31.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.33 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|