C11H15N3S2 — CID 106481560
2-piperidin-1-yl-5,7-dihydro-1H-thieno[3,4-d]pyrimidine-4-thione (PubChem CID 106481560) has the molecular formula C11H15N3S2 and a molecular weight of 253.40 g/mol. Its IUPAC name is 2-piperidin-1-yl-5,7-dihydro-1H-thieno[3,4-d]pyrimidine-4-thione.
| Compound Name | 2-piperidin-1-yl-5,7-dihydro-1H-thieno[3,4-d]pyrimidine-4-thione |
|---|---|
| PubChem CID | 106481560 |
| Molecular Formula | C11H15N3S2 |
| Molecular Weight | 253.40 g/mol |
| Exact Mass | 253.07 |
| IUPAC Name | 2-piperidin-1-yl-5,7-dihydro-1H-thieno[3,4-d]pyrimidine-4-thione |
| SMILES | S=c1nc(N2CCCCC2)[nH]c2c1CSC2 |
| InChI | InChI=1S/C11H15N3S2/c15-10-8-6-16-7-9(8)12-11(13-10)14-4-2-1-3-5-14/h1-7H2,(H,12,13,15) |
| InChIKey | KIICAYTWJFMVHX-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 31.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.40 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|