C10H12N2OS3 — CID 106481749
2-(1,4-oxathian-2-yl)-5,7-dihydro-1H-thieno[3,4-d]pyrimidine-4-thione (PubChem CID 106481749) has the molecular formula C10H12N2OS3 and a molecular weight of 272.42 g/mol. Its IUPAC name is 2-(1,4-oxathian-2-yl)-5,7-dihydro-1H-thieno[3,4-d]pyrimidine-4-thione.
| Compound Name | 2-(1,4-oxathian-2-yl)-5,7-dihydro-1H-thieno[3,4-d]pyrimidine-4-thione |
|---|---|
| PubChem CID | 106481749 |
| Molecular Formula | C10H12N2OS3 |
| Molecular Weight | 272.42 g/mol |
| Exact Mass | 272.01 |
| IUPAC Name | 2-(1,4-oxathian-2-yl)-5,7-dihydro-1H-thieno[3,4-d]pyrimidine-4-thione |
| SMILES | S=c1nc(C2CSCCO2)[nH]c2c1CSC2 |
| InChI | InChI=1S/C10H12N2OS3/c14-10-6-3-16-4-7(6)11-9(12-10)8-5-15-2-1-13-8/h8H,1-5H2,(H,11,12,14) |
| InChIKey | DPUTYUDDUOKOFV-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 37.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.42 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|