About 2-(oxolan-3-ylmethyl)-5,7-dihydro-1H-thieno[3,4-d]pyrimidine-4-thione
2-(oxolan-3-ylmethyl)-5,7-dihydro-1H-thieno[3,4-d]pyrimidine-4-thione (PubChem CID 106481793) has the molecular formula C11H14N2OS2
and a molecular weight of 254.38 g/mol. Its IUPAC name is 2-(oxolan-3-ylmethyl)-5,7-dihydro-1H-thieno[3,4-d]pyrimidine-4-thione.
Molecular Properties
| Compound Name | 2-(oxolan-3-ylmethyl)-5,7-dihydro-1H-thieno[3,4-d]pyrimidine-4-thione |
| PubChem CID | 106481793 |
| Molecular Formula | C11H14N2OS2 |
| Molecular Weight | 254.38 g/mol |
| Exact Mass | 254.05 |
| IUPAC Name | 2-(oxolan-3-ylmethyl)-5,7-dihydro-1H-thieno[3,4-d]pyrimidine-4-thione |
| SMILES | S=c1nc(CC2CCOC2)[nH]c2c1CSC2 |
| InChI | InChI=1S/C11H14N2OS2/c15-11-8-5-16-6-9(8)12-10(13-11)3-7-1-2-14-4-7/h7H,1-6H2,(H,12,13,15) |
| InChIKey | WPPHRIMDJOLPBJ-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 37.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 254.38 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 2-(oxolan-3-ylmethyl)-5,7-dihydro-1H-thieno[3,4-d]pyrimidine-4-thione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(oxolan-3-ylmethyl)-5,7-dihydro-1H-thieno[3,4-d]pyrimidine-4-thione?
The IUPAC name of 2-(oxolan-3-ylmethyl)-5,7-dihydro-1H-thieno[3,4-d]pyrimidine-4-thione (CID 106481793) is 2-(oxolan-3-ylmethyl)-5,7-dihydro-1H-thieno[3,4-d]pyrimidine-4-thione.
What is the SMILES notation for 2-(oxolan-3-ylmethyl)-5,7-dihydro-1H-thieno[3,4-d]pyrimidine-4-thione?
The canonical SMILES for 2-(oxolan-3-ylmethyl)-5,7-dihydro-1H-thieno[3,4-d]pyrimidine-4-thione is S=c1nc(CC2CCOC2)[nH]c2c1CSC2.
What is the InChIKey of 2-(oxolan-3-ylmethyl)-5,7-dihydro-1H-thieno[3,4-d]pyrimidine-4-thione?
The InChIKey is WPPHRIMDJOLPBJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14N2OS2/c15-11-8-5-16-6-9(8)12-10(13-11)3-7-1-2-14-4-7/h7H,1-6H2,(H,12,13,15).
What are the key properties of 2-(oxolan-3-ylmethyl)-5,7-dihydro-1H-thieno[3,4-d]pyrimidine-4-thione?
2-(oxolan-3-ylmethyl)-5,7-dihydro-1H-thieno[3,4-d]pyrimidine-4-thione has a molecular weight of 254.38 g/mol, XLogP of 2.46, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(oxolan-3-ylmethyl)-5,7-dihydro-1H-thieno[3,4-d]pyrimidine-4-thione is sourced from PubChem (CID 106481793), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).