C15H25N3S — CID 106481900
6-cyclopentyl-2-[2-(diethylamino)ethyl]-1H-pyrimidine-4-thione (PubChem CID 106481900) has the molecular formula C15H25N3S and a molecular weight of 279.45 g/mol. Its IUPAC name is 6-cyclopentyl-2-[2-(diethylamino)ethyl]-1H-pyrimidine-4-thione.
| Compound Name | 6-cyclopentyl-2-[2-(diethylamino)ethyl]-1H-pyrimidine-4-thione |
|---|---|
| PubChem CID | 106481900 |
| Molecular Formula | C15H25N3S |
| Molecular Weight | 279.45 g/mol |
| Exact Mass | 279.18 |
| IUPAC Name | 6-cyclopentyl-2-[2-(diethylamino)ethyl]-1H-pyrimidine-4-thione |
| SMILES | CCN(CC)CCc1nc(=S)cc(C2CCCC2)[nH]1 |
| InChI | InChI=1S/C15H25N3S/c1-3-18(4-2)10-9-14-16-13(11-15(19)17-14)12-7-5-6-8-12/h11-12H,3-10H2,1-2H3,(H,16,17,19) |
| InChIKey | SXGGLOWRXLHYJR-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 31.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.45 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|